Products 1006021-30-2
CAS 1006021-30-2 is the registry number for DNAC-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(5-bromo-3,4-dimethylthieno[2,3-b]thiophen-2-yl)-1H-pyrazole (CAS 1006021-30-2) is a chemical compound with the molecular formula C11H9BrN2S2 and a molecular weight of 313.2 g/mol. IUPAC name: 5-(5-bromo-3,4-dimethylthieno[2,3-b]thiophen-2-yl)-1H-pyrazole. InChIKey: MUNXAASMRMRSCE-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2S2 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 5-(5-bromo-3,4-dimethylthieno[2,3-b]thiophen-2-yl)-1H-pyrazole |
| InChIKey | MUNXAASMRMRSCE-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=C(S2)Br)C)C3=CC=NN3 |
Computed by PubChem (NCBI)