CAS 1006036-87-8 appears in our catalog under these names: MK-2894, 98+%, MK-2894/ min. 98%, MK–2894, MK 2894, MK-2894, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 50mg, 1mg, 5mg, 10mg, 25mg, 100mg, 500mg, 10mM (in 1ml dmso).
4-[1-[[2,5-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophene-3-carbonyl]amino]cyclopropyl]benzoic acid (CAS 1006036-87-8) is a chemical compound with the molecular formula C25H22F3NO3S and a molecular weight of 473.5 g/mol. IUPAC name: 4-[1-[[2,5-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophene-3-carbonyl]amino]cyclopropyl]benzoic acid. InChIKey: QJZQFVRFJCGDKF-UHFFFAOYSA-N.
| Molecular formula | C25H22F3NO3S |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | 4-[1-[[2,5-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophene-3-carbonyl]amino]cyclopropyl]benzoic acid |
| InChIKey | QJZQFVRFJCGDKF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(S1)C)C(=O)NC2(CC2)C3=CC=C(C=C3)C(=O)O)CC4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)