Products 1006334-29-7
CAS 1006334-29-7 is the registry number for 4-(5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]aniline (CAS 1006334-29-7) is a chemical compound with the molecular formula C13H12F3N3 and a molecular weight of 267.25 g/mol. IUPAC name: 4-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]aniline. InChIKey: VMHCNGQCZDPGFN-UHFFFAOYSA-N.
| Molecular formula | C13H12F3N3 |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | 4-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]aniline |
| InChIKey | VMHCNGQCZDPGFN-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=NN2C3=CC=C(C=C3)N)C(F)(F)F |
Computed by PubChem (NCBI)