CAS 1006348-88-4 is the registry number for 3-{(5-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)methyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoic acid (CAS 1006348-88-4) is a chemical compound with the molecular formula C13H11F3N2O2 and a molecular weight of 284.23 g/mol. IUPAC name: 3-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoic acid. InChIKey: LGBSJSPQMRYDBS-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O2 |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | 3-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoic acid |
| InChIKey | LGBSJSPQMRYDBS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=CC(=CC=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)