CAS 1006376-60-8 appears in our catalog under these names: Ticagrelor Impurity 54, (S)-2-Chloro-1-(3,4-difluorophenyl)ethanol, >95% (HPLC), (S)–2–Chloro–1–(3,4–difluorophenyl)ethanol, (S)-2-Chloro-1-(3,4-difluorophenyl)ethanol, (S)-2-Chloro-1-(3,4-difluorophenyl)ethanol 98%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 1g, 5g, 250mg, 25g, 10g, 15g, 100g.
(1S)-2-chloro-1-(3,4-difluorophenyl)ethanol (CAS 1006376-60-8) is a chemical compound with the molecular formula C8H7ClF2O and a molecular weight of 192.59 g/mol. IUPAC name: (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol. InChIKey: RYOLLNVCYSUXCP-MRVPVSSYSA-N.
| Molecular formula | C8H7ClF2O |
|---|---|
| Molecular weight | 192.59 g/mol |
| IUPAC name | (1S)-2-chloro-1-(3,4-difluorophenyl)ethanol |
| InChIKey | RYOLLNVCYSUXCP-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C=C1[C@@H](CCl)O)F)F |
Computed by PubChem (NCBI)