Products 1006390-25-5
CAS 1006390-25-5 appears in our catalog under these names: 2-(4-Bromo-3-methylphenyl)-2-methylpropanenitrile, 95%, 2-(4-Bromo-3-methylphenyl)-2-methylpropanenitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(4-bromo-3-methylphenyl)-2-methylpropanenitrile (CAS 1006390-25-5) is a chemical compound with the molecular formula C11H12BrN and a molecular weight of 238.12 g/mol. IUPAC name: 2-(4-bromo-3-methylphenyl)-2-methylpropanenitrile. InChIKey: AZUKMMFEPRVVEF-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN |
|---|---|
| Molecular weight | 238.12 g/mol |
| IUPAC name | 2-(4-bromo-3-methylphenyl)-2-methylpropanenitrile |
| InChIKey | AZUKMMFEPRVVEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C)(C)C#N)Br |
Computed by PubChem (NCBI)