Products 100644-28-8

CAS 100644-28-8 is the registry number for Pyridine-2-sulfinic chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Pyridine-2-sulfinyl chloride (CAS 100644-28-8) is a chemical compound with the molecular formula C5H4ClNOS and a molecular weight of 161.61 g/mol. IUPAC name: pyridine-2-sulfinyl chloride. InChIKey: WOSWNZQQNTZFKX-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4ClNOS
Molecular weight161.61 g/mol
IUPAC namepyridine-2-sulfinyl chloride
InChIKeyWOSWNZQQNTZFKX-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)S(=O)Cl

Computed by PubChem (NCBI)