CAS 1006442-43-8 is the registry number for 3-(3-Methoxy-4-nitro-1H-pyrazol-1-yl)propan-1-amine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-(3-methoxy-4-nitropyrazol-1-yl)propan-1-amine (CAS 1006442-43-8) is a chemical compound with the molecular formula C7H12N4O3 and a molecular weight of 200.20 g/mol. IUPAC name: 3-(3-methoxy-4-nitropyrazol-1-yl)propan-1-amine. InChIKey: PBLXFPJYQILWOA-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O3 |
|---|---|
| Molecular weight | 200.20 g/mol |
| IUPAC name | 3-(3-methoxy-4-nitropyrazol-1-yl)propan-1-amine |
| InChIKey | PBLXFPJYQILWOA-UHFFFAOYSA-N |
| SMILES | COC1=NN(C=C1[N+](=O)[O-])CCCN |
Computed by PubChem (NCBI)