CAS 1006459-45-5 appears in our catalog under these names: 2-[4-Nitro-3-(trifluoromethyl)-1h-pyrazol-1-yl]butanoic acid, 95%, 2-(4-Nitro-3-(trifluoromethyl)-1H-pyrazol-1-yl)butanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[4-nitro-3-(trifluoromethyl)pyrazol-1-yl]butanoic acid (CAS 1006459-45-5) is a chemical compound with the molecular formula C8H8F3N3O4 and a molecular weight of 267.16 g/mol. IUPAC name: 2-[4-nitro-3-(trifluoromethyl)pyrazol-1-yl]butanoic acid. InChIKey: JIHPLKCSWVVOEC-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N3O4 |
|---|---|
| Molecular weight | 267.16 g/mol |
| IUPAC name | 2-[4-nitro-3-(trifluoromethyl)pyrazol-1-yl]butanoic acid |
| InChIKey | JIHPLKCSWVVOEC-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)N1C=C(C(=N1)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)