CAS 1006461-11-5 appears in our catalog under these names: 3-[3-Methyl-5-(trifluoromethyl)-1h-pyrazol-1-yl]propanenitrile, 95%, 3-(3-Methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl)propanenitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg.
3-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]propanenitrile (CAS 1006461-11-5) is a chemical compound with the molecular formula C8H8F3N3 and a molecular weight of 203.16 g/mol. IUPAC name: 3-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]propanenitrile. InChIKey: ULNXSSWATIGXRM-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N3 |
|---|---|
| Molecular weight | 203.16 g/mol |
| IUPAC name | 3-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]propanenitrile |
| InChIKey | ULNXSSWATIGXRM-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(F)(F)F)CCC#N |
Computed by PubChem (NCBI)