CAS 1006470-56-9 is the registry number for 4-Bromo-1-cyclopentyl-1H-pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-bromo-1-cyclopentylpyrazol-3-amine (CAS 1006470-56-9) is a chemical compound with the molecular formula C8H12BrN3 and a molecular weight of 230.11 g/mol. IUPAC name: 4-bromo-1-cyclopentylpyrazol-3-amine. InChIKey: UBTYDZIXRUQARY-UHFFFAOYSA-N.
| Molecular formula | C8H12BrN3 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 4-bromo-1-cyclopentylpyrazol-3-amine |
| InChIKey | UBTYDZIXRUQARY-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C=C(C(=N2)N)Br |
Computed by PubChem (NCBI)