Products 1006471-24-4

CAS 1006471-24-4 is the registry number for 4-Bromo-1,5-dimethyl-1h-pyrazole-3-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-bromo-1,5-dimethylpyrazole-3-carbonyl chloride (CAS 1006471-24-4) is a chemical compound with the molecular formula C6H6BrClN2O and a molecular weight of 237.48 g/mol. IUPAC name: 4-bromo-1,5-dimethylpyrazole-3-carbonyl chloride. InChIKey: AGNCUIDMDNDBBT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6BrClN2O
Molecular weight237.48 g/mol
IUPAC name4-bromo-1,5-dimethylpyrazole-3-carbonyl chloride
InChIKeyAGNCUIDMDNDBBT-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C)C(=O)Cl)Br

Computed by PubChem (NCBI)