Products 1006473-52-4
CAS 1006473-52-4 appears in our catalog under these names: 2-Methyl-2-(3-methyl-1H-pyrazol-1-yl)propanoic acid, 98%, 2-Methyl-2-(3-methyl-1H-pyrazol-1-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-methyl-2-(3-methylpyrazol-1-yl)propanoic acid (CAS 1006473-52-4) is a chemical compound with the molecular formula C8H12N2O2 and a molecular weight of 168.19 g/mol. IUPAC name: 2-methyl-2-(3-methylpyrazol-1-yl)propanoic acid. InChIKey: YVHCBXLFZXPSCL-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 2-methyl-2-(3-methylpyrazol-1-yl)propanoic acid |
| InChIKey | YVHCBXLFZXPSCL-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1)C(C)(C)C(=O)O |
Computed by PubChem (NCBI)