Products 1006592-61-5
CAS 1006592-61-5 appears in our catalog under these names: 5-TAMRAazide, 5-TAMRA Azide, Tamra azide, 99.89%. Offered by: Chemat, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 5 mg.
5-(6-azidohexylcarbamoyl)-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate (CAS 1006592-61-5) is a chemical compound with the molecular formula C31H34N6O4 and a molecular weight of 554.6 g/mol. IUPAC name: 5-(6-azidohexylcarbamoyl)-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate. InChIKey: RWQBZVZBWNOHJV-UHFFFAOYSA-N.
| Molecular formula | C31H34N6O4 |
|---|---|
| Molecular weight | 554.6 g/mol |
| IUPAC name | 5-(6-azidohexylcarbamoyl)-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate |
| InChIKey | RWQBZVZBWNOHJV-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=C(C=C4)C(=O)NCCCCCCN=[N+]=[N-])C(=O)[O-] |
Computed by PubChem (NCBI)