CAS 1006608-03-2 is the registry number for 1,3,5–Tri–p–(tetrazol–5–yl)phenylbenzene. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
5-[4-[3,5-bis[4-(2H-tetrazol-5-yl)phenyl]phenyl]phenyl]-2H-tetrazole (CAS 1006608-03-2) is a chemical compound with the molecular formula C27H18N12 and a molecular weight of 510.5 g/mol. IUPAC name: 5-[4-[3,5-bis[4-(2H-tetrazol-5-yl)phenyl]phenyl]phenyl]-2H-tetrazole. InChIKey: CGCMZTOFKIYWDN-UHFFFAOYSA-N.
| Molecular formula | C27H18N12 |
|---|---|
| Molecular weight | 510.5 g/mol |
| IUPAC name | 5-[4-[3,5-bis[4-(2H-tetrazol-5-yl)phenyl]phenyl]phenyl]-2H-tetrazole |
| InChIKey | CGCMZTOFKIYWDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C3=CC=C(C=C3)C4=NNN=N4)C5=CC=C(C=C5)C6=NNN=N6)C7=NNN=N7 |
Computed by PubChem (NCBI)