CAS 1006724-55-5 appears in our catalog under these names: Alfuzosin-d3, Alfuzosin–d3, Alfuzosin-d3, 99.90%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 1 mg.
N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-(trideuteriomethyl)amino]propyl]oxolane-2-carboxamide (CAS 1006724-55-5) is a chemical compound with the molecular formula C19H27N5O4 and a molecular weight of 392.5 g/mol. IUPAC name: N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-(trideuteriomethyl)amino]propyl]oxolane-2-carboxamide. InChIKey: WNMJYKCGWZFFKR-FIBGUPNXSA-N.
| Molecular formula | C19H27N5O4 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | N-[3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-(trideuteriomethyl)amino]propyl]oxolane-2-carboxamide |
| InChIKey | WNMJYKCGWZFFKR-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCNC(=O)C1CCCO1)C2=NC3=CC(=C(C=C3C(=N2)N)OC)OC |
Computed by PubChem (NCBI)