CAS 100684-36-4 is the registry number for Hexapeptide-11. Offered by: Creative Peptides. Available pack sizes: on request.
3',6'-bis(diethylamino)-5-isothiocyanatospiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 100684-36-4) is a chemical compound with the molecular formula C29H29N3O3S and a molecular weight of 499.6 g/mol. IUPAC name: 3',6'-bis(diethylamino)-5-isothiocyanatospiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: OTFIRIMNKLNLIK-UHFFFAOYSA-N.
| Molecular formula | C29H29N3O3S |
|---|---|
| Molecular weight | 499.6 g/mol |
| IUPAC name | 3',6'-bis(diethylamino)-5-isothiocyanatospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | OTFIRIMNKLNLIK-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)N(CC)CC)C5=C(C=CC(=C5)N=C=S)C(=O)O3 |
Computed by PubChem (NCBI)