Products 1006993-36-7

CAS 1006993-36-7 is the registry number for 3-(4-Bromo-3-nitro-1H-pyrazol-1-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(4-bromo-3-nitropyrazol-1-yl)propanoic acid (CAS 1006993-36-7) is a chemical compound with the molecular formula C6H6BrN3O4 and a molecular weight of 264.03 g/mol. IUPAC name: 3-(4-bromo-3-nitropyrazol-1-yl)propanoic acid. InChIKey: ZZMXTQHEZQCMRL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6BrN3O4
Molecular weight264.03 g/mol
IUPAC name3-(4-bromo-3-nitropyrazol-1-yl)propanoic acid
InChIKeyZZMXTQHEZQCMRL-UHFFFAOYSA-N
SMILESC1=C(C(=NN1CCC(=O)O)[N+](=O)[O-])Br

Computed by PubChem (NCBI)