CAS 1007011-49-5 is the registry number for Sodium 1-ethyl-1H-imidazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
Sodium 1-ethylimidazole-2-carboxylate (CAS 1007011-49-5) is a chemical compound with the molecular formula C6H7N2NaO2 and a molecular weight of 162.12 g/mol. IUPAC name: sodium 1-ethylimidazole-2-carboxylate. InChIKey: OLVSIPXDVKZZEC-UHFFFAOYSA-M.
| Molecular formula | C6H7N2NaO2 |
|---|---|
| Molecular weight | 162.12 g/mol |
| IUPAC name | sodium 1-ethylimidazole-2-carboxylate |
| InChIKey | OLVSIPXDVKZZEC-UHFFFAOYSA-M |
| SMILES | CCN1C=CN=C1C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)