CAS 1007016-49-0 appears in our catalog under these names: Sodium [2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate, 95%, Sodium 2-(2-(3-phenoxyphenyl)-1,3-thiazol-4-yl)acetate, 95%, Sodium 2-(2-(3-phenoxyphenyl)-1,3-thiazol-4-yl)acetate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
Sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate (CAS 1007016-49-0) is a chemical compound with the molecular formula C17H12NNaO3S and a molecular weight of 333.3 g/mol. IUPAC name: sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate. InChIKey: HOKQEQWPZCJPGM-UHFFFAOYSA-M.
| Molecular formula | C17H12NNaO3S |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | sodium 2-[2-(3-phenoxyphenyl)-1,3-thiazol-4-yl]acetate |
| InChIKey | HOKQEQWPZCJPGM-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C3=NC(=CS3)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)