CAS 1007036-34-1 appears in our catalog under these names: Potassium (2,2,2-trifluoroethoxy)acetate, 95%, Potassium 2–(2,2,2–trifluoroethoxy)acetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 2,5g, 50mg, 500mg.
Potassium 2-(2,2,2-trifluoroethoxy)acetate (CAS 1007036-34-1) is a chemical compound with the molecular formula C4H4F3KO3 and a molecular weight of 196.17 g/mol. IUPAC name: potassium 2-(2,2,2-trifluoroethoxy)acetate. InChIKey: KYCYPJDZGSYIMO-UHFFFAOYSA-M.
| Molecular formula | C4H4F3KO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | potassium 2-(2,2,2-trifluoroethoxy)acetate |
| InChIKey | KYCYPJDZGSYIMO-UHFFFAOYSA-M |
| SMILES | C(C(=O)[O-])OCC(F)(F)F.[K+] |
Computed by PubChem (NCBI)