CAS 100707-40-2 appears in our catalog under these names: 2-Bromo-5-nitrobenzenesulfonamide, 97%, 2-Bromo-5-nitrobenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-bromo-5-nitrobenzenesulfonamide (CAS 100707-40-2) is a chemical compound with the molecular formula C6H5BrN2O4S and a molecular weight of 281.09 g/mol. IUPAC name: 2-bromo-5-nitrobenzenesulfonamide. InChIKey: QHNUANJNVBNJNC-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O4S |
|---|---|
| Molecular weight | 281.09 g/mol |
| IUPAC name | 2-bromo-5-nitrobenzenesulfonamide |
| InChIKey | QHNUANJNVBNJNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)N)Br |
Computed by PubChem (NCBI)