CAS 1007112-88-0 is the registry number for (S)-tert-Butyl 3-(tert-butyl)piperazine-1-carboxylate, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (3S)-3-tert-butylpiperazine-1-carboxylate (CAS 1007112-88-0) is a chemical compound with the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. IUPAC name: tert-butyl (3S)-3-tert-butylpiperazine-1-carboxylate. InChIKey: LCTYDUNZQLEACC-SNVBAGLBSA-N.
| Molecular formula | C13H26N2O2 |
|---|---|
| Molecular weight | 242.36 g/mol |
| IUPAC name | tert-butyl (3S)-3-tert-butylpiperazine-1-carboxylate |
| InChIKey | LCTYDUNZQLEACC-SNVBAGLBSA-N |
| SMILES | CC(C)(C)[C@H]1CN(CCN1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)