CAS 1007189-79-8 is the registry number for Potassium 4-(4-hydroxy-3-nitrobenzenesulfonamido)benzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Potassium 4-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoate (CAS 1007189-79-8) is a chemical compound with the molecular formula C13H9KN2O7S and a molecular weight of 376.38 g/mol. IUPAC name: potassium 4-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoate. InChIKey: YHZDFTHNZMDQQH-UHFFFAOYSA-M.
| Molecular formula | C13H9KN2O7S |
|---|---|
| Molecular weight | 376.38 g/mol |
| IUPAC name | potassium 4-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoate |
| InChIKey | YHZDFTHNZMDQQH-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C(=O)[O-])NS(=O)(=O)C2=CC(=C(C=C2)O)[N+](=O)[O-].[K+] |
Computed by PubChem (NCBI)