CAS 1007190-20-6 is the registry number for Potassium 3-(4-(N,N-diethylsulfamoyl)phenyl)acrylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate (CAS 1007190-20-6) is a chemical compound with the molecular formula C13H16KNO4S and a molecular weight of 321.44 g/mol. IUPAC name: potassium (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate. InChIKey: VERVMFXTUAVURM-HCUGZAAXSA-M.
| Molecular formula | C13H16KNO4S |
|---|---|
| Molecular weight | 321.44 g/mol |
| IUPAC name | potassium (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
| InChIKey | VERVMFXTUAVURM-HCUGZAAXSA-M |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)/C=C/C(=O)[O-].[K+] |
Computed by PubChem (NCBI)