CAS 1007190-42-2 is the registry number for Potassium 2-((4-acetamidophenyl)sulfanyl)acetate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Potassium 2-(4-acetamidophenyl)sulfanylacetate (CAS 1007190-42-2) is a chemical compound with the molecular formula C10H10KNO3S and a molecular weight of 263.36 g/mol. IUPAC name: potassium 2-(4-acetamidophenyl)sulfanylacetate. InChIKey: RGGQDGRKURHWRL-UHFFFAOYSA-M.
| Molecular formula | C10H10KNO3S |
|---|---|
| Molecular weight | 263.36 g/mol |
| IUPAC name | potassium 2-(4-acetamidophenyl)sulfanylacetate |
| InChIKey | RGGQDGRKURHWRL-UHFFFAOYSA-M |
| SMILES | CC(=O)NC1=CC=C(C=C1)SCC(=O)[O-].[K+] |
Computed by PubChem (NCBI)