CAS 1007190-44-4 appears in our catalog under these names: potassium 4-hydroxy-1-phenyl-1h-pyrazole-3-carboxylate, 95%, Potassium 4-hydroxy-1-phenyl-1H-pyrazole-3-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
Potassium 4-hydroxy-1-phenylpyrazole-3-carboxylate (CAS 1007190-44-4) is a chemical compound with the molecular formula C10H7KN2O3 and a molecular weight of 242.27 g/mol. IUPAC name: potassium 4-hydroxy-1-phenylpyrazole-3-carboxylate. InChIKey: MEXCRCXTORQMOQ-UHFFFAOYSA-M.
| Molecular formula | C10H7KN2O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | potassium 4-hydroxy-1-phenylpyrazole-3-carboxylate |
| InChIKey | MEXCRCXTORQMOQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C(=O)[O-])O.[K+] |
Computed by PubChem (NCBI)