CAS 100728-67-4 is the registry number for 5-[(1-Naphthylmethyl)thio]-1,3,4-thiadiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine (CAS 100728-67-4) is a chemical compound with the molecular formula C13H11N3S2 and a molecular weight of 273.4 g/mol. IUPAC name: 5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine. InChIKey: FVZXNLYVWPHMAT-UHFFFAOYSA-N.
| Molecular formula | C13H11N3S2 |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | 5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | FVZXNLYVWPHMAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CSC3=NN=C(S3)N |
Computed by PubChem (NCBI)