CAS 1007311-98-9 appears in our catalog under these names: Dicyclohexyl(9-butylfluoren-9-yl)phosphonium tetrafluoroborate, 97%, (9-Butyl-9-fluorenyl)dicyclo-hexylphosphonium tetrafluoroborate, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 500mg, 100mg.
(9-butylfluoren-9-yl)-dicyclohexylphosphanium tetrafluoroborate (CAS 1007311-98-9) is a chemical compound with the molecular formula C29H40BF4P and a molecular weight of 506.4 g/mol. IUPAC name: (9-butylfluoren-9-yl)-dicyclohexylphosphanium tetrafluoroborate. InChIKey: CBQHWERYDVYPPB-UHFFFAOYSA-O.
| Molecular formula | C29H40BF4P |
|---|---|
| Molecular weight | 506.4 g/mol |
| IUPAC name | (9-butylfluoren-9-yl)-dicyclohexylphosphanium tetrafluoroborate |
| InChIKey | CBQHWERYDVYPPB-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.CCCCC1(C2=CC=CC=C2C3=CC=CC=C31)[PH+](C4CCCCC4)C5CCCCC5 |
Computed by PubChem (NCBI)