Products 1007477-29-3
CAS 1007477-29-3 is the registry number for Sodium 3-methyl-2-oxobutanoate-13C2,d4. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
CAS 1007477-29-3 identifies a chemical compound with the molecular formula C5H8NaO3 and a molecular weight of 145.11 g/mol. InChIKey: ZYUOMWUHRSDZMY-YVAKGFCFSA-N.
| Molecular formula | C5H8NaO3 |
|---|---|
| Molecular weight | 145.11 g/mol |
| InChIKey | ZYUOMWUHRSDZMY-YVAKGFCFSA-N |
| SMILES | [2H][13CH]([2H])C([13CH]([2H])[2H])C(=O)C(=O)O.[Na] |
Computed by PubChem (NCBI)