CAS 100751-65-3 is the registry number for 2-(t-Butyldimethylsilyloxy)-6-bromonaphthalene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.
(6-bromonaphthalen-2-yl)oxy-tert-butyl-dimethylsilane (CAS 100751-65-3) is a chemical compound with the molecular formula C16H21BrOSi and a molecular weight of 337.33 g/mol. IUPAC name: (6-bromonaphthalen-2-yl)oxy-tert-butyl-dimethylsilane. InChIKey: SSFFBVWGOVGZJB-UHFFFAOYSA-N.
| Molecular formula | C16H21BrOSi |
|---|---|
| Molecular weight | 337.33 g/mol |
| IUPAC name | (6-bromonaphthalen-2-yl)oxy-tert-butyl-dimethylsilane |
| InChIKey | SSFFBVWGOVGZJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)