CAS 100751-82-4 is the registry number for B-GYKI-38233 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride (CAS 100751-82-4) is a chemical compound with the molecular formula C11H19ClN4 and a molecular weight of 242.75 g/mol. IUPAC name: 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride. InChIKey: LBTUHNNCEFYFFH-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN4 |
|---|---|
| Molecular weight | 242.75 g/mol |
| IUPAC name | 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride |
| InChIKey | LBTUHNNCEFYFFH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N/N=C(/N)\N(C)C.Cl |
Computed by PubChem (NCBI)