CAS 1007518-42-4 appears in our catalog under these names: 1-[3,5-Dimethyl-1-(propan-2-yl)-1h-pyrazol-4-yl]ethan-1-one, 95%, 1-(3,5-Dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl)ethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 0,5g.
1-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)ethanone (CAS 1007518-42-4) is a chemical compound with the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. IUPAC name: 1-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)ethanone. InChIKey: BJYVVHKNACUSFK-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O |
|---|---|
| Molecular weight | 180.25 g/mol |
| IUPAC name | 1-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)ethanone |
| InChIKey | BJYVVHKNACUSFK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C(C)C)C)C(=O)C |
Computed by PubChem (NCBI)