CAS 1007597-56-9 appears in our catalog under these names: (E)-5,5'-(Diazene-1,2-diyl)diisophthalic acid, 97%, 97%, (E)-5,5'-(Diazene-1,2-diyl)diisophthalic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
5-[(3,5-dicarboxyphenyl)diazenyl]benzene-1,3-dicarboxylic acid (CAS 1007597-56-9) is a chemical compound with the molecular formula C16H10N2O8 and a molecular weight of 358.26 g/mol. IUPAC name: 5-[(3,5-dicarboxyphenyl)diazenyl]benzene-1,3-dicarboxylic acid. InChIKey: MXBBZODCMBYDCL-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O8 |
|---|---|
| Molecular weight | 358.26 g/mol |
| IUPAC name | 5-[(3,5-dicarboxyphenyl)diazenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | MXBBZODCMBYDCL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)N=NC2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)