Products 1007652-84-7
CAS 1007652-84-7 appears in our catalog under these names: Procaine Impurity 3, Otilonium Bromide Impurity A, Otilonium Bromide Impurity 2, Procaine Impurity 4, 2-(Diethylamino)ethyl 4-(2-Hydroxybenzamido)benzoate, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
2-(diethylamino)ethyl 4-[(2-hydroxybenzoyl)amino]benzoate (CAS 1007652-84-7) is a chemical compound with the molecular formula C20H24N2O4 and a molecular weight of 356.4 g/mol. IUPAC name: 2-(diethylamino)ethyl 4-[(2-hydroxybenzoyl)amino]benzoate. InChIKey: WIMPOBHGMUVPQX-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O4 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 2-(diethylamino)ethyl 4-[(2-hydroxybenzoyl)amino]benzoate |
| InChIKey | WIMPOBHGMUVPQX-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2O |
Computed by PubChem (NCBI)