Products 1007717-83-0
CAS 1007717-83-0 is the registry number for 4-Methyl-6-((4-methylthiazol-2-yl)thio)pyrimidin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidin-2-amine (CAS 1007717-83-0) is a chemical compound with the molecular formula C9H10N4S2 and a molecular weight of 238.3 g/mol. IUPAC name: 4-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidin-2-amine. InChIKey: AJMYPBLFWRHTPH-UHFFFAOYSA-N.
| Molecular formula | C9H10N4S2 |
|---|---|
| Molecular weight | 238.3 g/mol |
| IUPAC name | 4-methyl-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidin-2-amine |
| InChIKey | AJMYPBLFWRHTPH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N)SC2=NC(=CS2)C |
Computed by PubChem (NCBI)