CAS 1007786-48-2 is the registry number for JNK-IN-23. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,6-dimethyl-2-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-3H-thieno[2,3-d]pyrimidin-4-one (CAS 1007786-48-2) is a chemical compound with the molecular formula C19H18N4OS2 and a molecular weight of 382.5 g/mol. IUPAC name: 5,6-dimethyl-2-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: ZYCFQLYFRCQEMK-UHFFFAOYSA-N.
| Molecular formula | C19H18N4OS2 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 5,6-dimethyl-2-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | ZYCFQLYFRCQEMK-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)NC(=N2)C(C)SC3=NC4=CC=CC=C4N=C3C)C |
Computed by PubChem (NCBI)