CAS 10078-25-8 appears in our catalog under these names: Perphenazine Sulfoxide, Perphenazine EP Impurity A, Perphenazine EP Impurity A, Perphenazine sulfoxide, Perphenazine Sulfoxide, >95% (HPLC), 2-(4-(3-(2-Chloro-5-oxido-10H-phenothiazin-10-yl)propyl)piperazin-1-yl)ethanol (Perphenazine Sulphoxide). Offered by: GLPBio, Chemat Brand, TRC, Mikromol, LoGiCal. Available pack sizes: 25mg, on request, 250mg, 100mg, 10mg, 1ml, 5mg, Get quote.
2-[4-[3-(2-chloro-5-oxophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol (CAS 10078-25-8) is a chemical compound with the molecular formula C21H26ClN3O2S and a molecular weight of 420.0 g/mol. IUPAC name: 2-[4-[3-(2-chloro-5-oxophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol. InChIKey: WXJXTMQMAOYROI-UHFFFAOYSA-N.
| Molecular formula | C21H26ClN3O2S |
|---|---|
| Molecular weight | 420.0 g/mol |
| IUPAC name | 2-[4-[3-(2-chloro-5-oxophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol |
| InChIKey | WXJXTMQMAOYROI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCN2C3=CC=CC=C3S(=O)C4=C2C=C(C=C4)Cl)CCO |
Computed by PubChem (NCBI)