CAS 10078-27-0 appears in our catalog under these names: Prochlorperazine EP Impurity A, Prochlorperazine Sulfoxide, Prochlorperazine Maleate EP Impurity A, Prochlorperazine Sulfoxide, ≥95%, ≥95%, Prochlorperazine-d8 sulfoxide. Offered by: Chemat Brand, TRC, Mikromol, Chemat. Available pack sizes: on request, 10mg, 1mg, 25mg, 4x25mg, 100mg, 5mg, 50mg.
(5S)-2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine 5-oxide (CAS 10078-27-0) is a chemical compound with the molecular formula C20H24ClN3OS and a molecular weight of 389.9 g/mol. IUPAC name: (5S)-2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine 5-oxide. InChIKey: AZGYHFQQUZPAFZ-SANMLTNESA-N.
| Molecular formula | C20H24ClN3OS |
|---|---|
| Molecular weight | 389.9 g/mol |
| IUPAC name | (5S)-2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine 5-oxide |
| InChIKey | AZGYHFQQUZPAFZ-SANMLTNESA-N |
| SMILES | CN1CCN(CC1)CCCN2C3=CC=CC=C3[S@](=O)C4=C2C=C(C=C4)Cl |
Computed by PubChem (NCBI)