CAS 1007853-40-8 is the registry number for WAY-214156. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-4,12-dicarbonitrile (CAS 1007853-40-8) is a chemical compound with the molecular formula C19H10N2O3 and a molecular weight of 314.3 g/mol. IUPAC name: 2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-4,12-dicarbonitrile. InChIKey: UGZYFAJTTRGNOX-UHFFFAOYSA-N.
| Molecular formula | C19H10N2O3 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-4,12-dicarbonitrile |
| InChIKey | UGZYFAJTTRGNOX-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)O)C3=C(O1)C4=C(C=C(C=C4C(=C3)C#N)O)C#N |
Computed by PubChem (NCBI)