Products 1007880-55-8
CAS 1007880-55-8 is the registry number for (R)-2-(Diethylamino)-3-methylbutanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-(diethylamino)-3-methylbutanoic acid (CAS 1007880-55-8) is a chemical compound with the molecular formula C9H19NO2 and a molecular weight of 173.25 g/mol. IUPAC name: (2R)-2-(diethylamino)-3-methylbutanoic acid. InChIKey: XUWHRJBRJWTAPR-MRVPVSSYSA-N.
| Molecular formula | C9H19NO2 |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | (2R)-2-(diethylamino)-3-methylbutanoic acid |
| InChIKey | XUWHRJBRJWTAPR-MRVPVSSYSA-N |
| SMILES | CCN(CC)[C@H](C(C)C)C(=O)O |
Computed by PubChem (NCBI)