CAS 10079-35-3 appears in our catalog under these names: Glibenclamide (Glyburide) EP Impurity C (Glipizide EP Impurity I), Glipizide Impurity I(EP), Glipizide EP Impurity I,Glibenclamide EP Impurity C, N-(4-(beta-Cyclohexylureidoethyl)benzensulfonyl) N'-Cyclohexylurea, >95% (HPLC), N-(Cyclohexylcarbamoyl)-4-(2-((cyclohexylcarbamoyl)amino)ethyl)benzenesulphonamide. Offered by: Chemat Brand, TRC, Mikromol, Chemat. Available pack sizes: on request, 500mg, 50mg, 4x25mg, 25mg, 100mg, 10mg.
1-cyclohexyl-3-[4-[2-(cyclohexylcarbamoylamino)ethyl]phenyl]sulfonylurea (CAS 10079-35-3) is a chemical compound with the molecular formula C22H34N4O4S and a molecular weight of 450.6 g/mol. IUPAC name: 1-cyclohexyl-3-[4-[2-(cyclohexylcarbamoylamino)ethyl]phenyl]sulfonylurea. InChIKey: FYNBBKUBRFUWKU-UHFFFAOYSA-N.
| Molecular formula | C22H34N4O4S |
|---|---|
| Molecular weight | 450.6 g/mol |
| IUPAC name | 1-cyclohexyl-3-[4-[2-(cyclohexylcarbamoylamino)ethyl]phenyl]sulfonylurea |
| InChIKey | FYNBBKUBRFUWKU-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)NC3CCCCC3 |
Computed by PubChem (NCBI)