CAS 1007912-97-1 appears in our catalog under these names: (2S,4R)-4-Fluoro-1-methylpyrrolidine-2-carboxylic acid, 95%, (2S,4R)-4-Fluoro-1-methylpyrrolidine-2-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(2S,4R)-4-fluoro-1-methylpyrrolidine-2-carboxylic acid (CAS 1007912-97-1) is a chemical compound with the molecular formula C6H10FNO2 and a molecular weight of 147.15 g/mol. IUPAC name: (2S,4R)-4-fluoro-1-methylpyrrolidine-2-carboxylic acid. InChIKey: WWTABXAXNXQPOH-UHNVWZDZSA-N.
| Molecular formula | C6H10FNO2 |
|---|---|
| Molecular weight | 147.15 g/mol |
| IUPAC name | (2S,4R)-4-fluoro-1-methylpyrrolidine-2-carboxylic acid |
| InChIKey | WWTABXAXNXQPOH-UHNVWZDZSA-N |
| SMILES | CN1C[C@@H](C[C@H]1C(=O)O)F |
Computed by PubChem (NCBI)