Products 1008052-21-8
CAS 1008052-21-8 is the registry number for 2–(4–(2–Methylphenoxy)benzenesulfonamido)–3–phenylpropanoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-[[4-(2-methylphenoxy)phenyl]sulfonylamino]-3-phenylpropanoic acid (CAS 1008052-21-8) is a chemical compound with the molecular formula C22H21NO5S and a molecular weight of 411.5 g/mol. IUPAC name: 2-[[4-(2-methylphenoxy)phenyl]sulfonylamino]-3-phenylpropanoic acid. InChIKey: KRUVZJXWRXSMFO-UHFFFAOYSA-N.
| Molecular formula | C22H21NO5S |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | 2-[[4-(2-methylphenoxy)phenyl]sulfonylamino]-3-phenylpropanoic acid |
| InChIKey | KRUVZJXWRXSMFO-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OC2=CC=C(C=C2)S(=O)(=O)NC(CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)