CAS 1008361-65-6 appears in our catalog under these names: 5–Bromo–6–methoxy–1H–benzo(d)imidazole, 6-Bromo-5-methoxy-1H-benzimidazole, 95%, 95%, 5-Bromo-6-methoxy-1H-benzo[d]imidazole, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 25g.
6-bromo-5-methoxy-1H-benzimidazole (CAS 1008361-65-6) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 6-bromo-5-methoxy-1H-benzimidazole. InChIKey: BAAJXZAAZDCTGW-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 6-bromo-5-methoxy-1H-benzimidazole |
| InChIKey | BAAJXZAAZDCTGW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CN2)Br |
Computed by PubChem (NCBI)