CAS 100842-21-5 appears in our catalog under these names: α-D-Xylopyranosyl azide, a-D-Xylopyranosyl azide. Offered by: Chemat, Biosynth. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 500mg, 1000mg.
(2S,3R,4S,5R)-2-azidooxane-3,4,5-triol (CAS 100842-21-5) is a chemical compound with the molecular formula C5H9N3O4 and a molecular weight of 175.14 g/mol. IUPAC name: (2S,3R,4S,5R)-2-azidooxane-3,4,5-triol. InChIKey: WVWBURHISBVZHI-LECHCGJUSA-N.
| Molecular formula | C5H9N3O4 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-azidooxane-3,4,5-triol |
| InChIKey | WVWBURHISBVZHI-LECHCGJUSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@H](O1)N=[N+]=[N-])O)O)O |
Computed by PubChem (NCBI)