CAS 1008529-42-7 is the registry number for ABT-116. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[[2-(3,3-dimethylbutyl)-4-(trifluoromethyl)phenyl]methyl]-3-(1-methylindazol-4-yl)urea (CAS 1008529-42-7) is a chemical compound with the molecular formula C23H27F3N4O and a molecular weight of 432.5 g/mol. IUPAC name: 1-[[2-(3,3-dimethylbutyl)-4-(trifluoromethyl)phenyl]methyl]-3-(1-methylindazol-4-yl)urea. InChIKey: SMJCAASNPAKOIB-UHFFFAOYSA-N.
| Molecular formula | C23H27F3N4O |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | 1-[[2-(3,3-dimethylbutyl)-4-(trifluoromethyl)phenyl]methyl]-3-(1-methylindazol-4-yl)urea |
| InChIKey | SMJCAASNPAKOIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CCC1=C(C=CC(=C1)C(F)(F)F)CNC(=O)NC2=C3C=NN(C3=CC=C2)C |
Computed by PubChem (NCBI)