CAS 1008582-71-5 appears in our catalog under these names: 5-Amino-5-oxo-2-(([3-(trifluoromethyl)phenyl]sulfonyl)amino)pentanoic acid, 95%, 4-Carbamoyl-2-(3-(trifluoromethyl)benzenesulfonamido)butanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
5-amino-5-oxo-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoic acid (CAS 1008582-71-5) is a chemical compound with the molecular formula C12H13F3N2O5S and a molecular weight of 354.30 g/mol. IUPAC name: 5-amino-5-oxo-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoic acid. InChIKey: DKNVCRCWOLHANY-UHFFFAOYSA-N.
| Molecular formula | C12H13F3N2O5S |
|---|---|
| Molecular weight | 354.30 g/mol |
| IUPAC name | 5-amino-5-oxo-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoic acid |
| InChIKey | DKNVCRCWOLHANY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NC(CCC(=O)N)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)