CAS 1008675-36-2 appears in our catalog under these names: 2-{(2-chloro-5-(dimethylsulfamoyl)phenyl)formamido}propanoic acid, 95%, 2-((2-Chloro-5-[(dimethylamino)sulfonyl]benzoyl)amino)propanoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
2-[[2-chloro-5-(dimethylsulfamoyl)benzoyl]amino]propanoic acid (CAS 1008675-36-2) is a chemical compound with the molecular formula C12H15ClN2O5S and a molecular weight of 334.78 g/mol. IUPAC name: 2-[[2-chloro-5-(dimethylsulfamoyl)benzoyl]amino]propanoic acid. InChIKey: QHUHRLXGZMYZIF-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O5S |
|---|---|
| Molecular weight | 334.78 g/mol |
| IUPAC name | 2-[[2-chloro-5-(dimethylsulfamoyl)benzoyl]amino]propanoic acid |
| InChIKey | QHUHRLXGZMYZIF-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)C1=C(C=CC(=C1)S(=O)(=O)N(C)C)Cl |
Computed by PubChem (NCBI)