CAS 1008742-31-1 is the registry number for 6-Fluoro-3H-1,2,3-benzotriazin-4-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
6-fluoro-3H-1,2,3-benzotriazin-4-one (CAS 1008742-31-1) is a chemical compound with the molecular formula C7H4FN3O and a molecular weight of 165.12 g/mol. IUPAC name: 6-fluoro-3H-1,2,3-benzotriazin-4-one. InChIKey: RCLQFKLASUKMCG-UHFFFAOYSA-N.
| Molecular formula | C7H4FN3O |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 6-fluoro-3H-1,2,3-benzotriazin-4-one |
| InChIKey | RCLQFKLASUKMCG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)NN=N2 |
Computed by PubChem (NCBI)